C15H13BrN2 — CID 138515649
2-(5-bromo-2-methylphenyl)-3-methylimidazo[1,2-a]pyridine (PubChem CID 138515649) has the molecular formula C15H13BrN2 and a molecular weight of 301.19 g/mol. Its IUPAC name is 2-(5-bromo-2-methylphenyl)-3-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-(5-bromo-2-methylphenyl)-3-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 138515649 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-(5-bromo-2-methylphenyl)-3-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(Br)cc1-c1nc2ccccn2c1C |
| InChI | InChI=1S/C15H13BrN2/c1-10-6-7-12(16)9-13(10)15-11(2)18-8-4-3-5-14(18)17-15/h3-9H,1-2H3 |
| InChIKey | IHKPJOCWTWLRPW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |