C16H15ClN2 — CID 39132917
3-(chloromethyl)-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine (PubChem CID 39132917) has the molecular formula C16H15ClN2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(chloromethyl)-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 39132917 |
| Molecular Formula | C16H15ClN2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-(chloromethyl)-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(-c2nc3ccccn3c2CCl)cc1C |
| InChI | InChI=1S/C16H15ClN2/c1-11-6-7-13(9-12(11)2)16-14(10-17)19-8-4-3-5-15(19)18-16/h3-9H,10H2,1-2H3 |
| InChIKey | INNVERPGVQATMO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|