C15H12Cl2N2 — CID 39132933
3-(chloromethyl)-2-(4-chloro-3-methylphenyl)imidazo[1,2-a]pyridine (PubChem CID 39132933) has the molecular formula C15H12Cl2N2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(4-chloro-3-methylphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(chloromethyl)-2-(4-chloro-3-methylphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 39132933 |
| Molecular Formula | C15H12Cl2N2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 3-(chloromethyl)-2-(4-chloro-3-methylphenyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1cc(-c2nc3ccccn3c2CCl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2N2/c1-10-8-11(5-6-12(10)17)15-13(9-16)19-7-3-2-4-14(19)18-15/h2-8H,9H2,1H3 |
| InChIKey | JVOKMBHSDKRMOW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|