C17H17ClN2 — CID 39126353
3-(chloromethyl)-2-(3,4-dimethylphenyl)-8-methylimidazo[1,2-a]pyridine (PubChem CID 39126353) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(3,4-dimethylphenyl)-8-methylimidazo[1,2-a]pyridine.
| Compound Name | 3-(chloromethyl)-2-(3,4-dimethylphenyl)-8-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 39126353 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-(chloromethyl)-2-(3,4-dimethylphenyl)-8-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(-c2nc3c(C)cccn3c2CCl)cc1C |
| InChI | InChI=1S/C17H17ClN2/c1-11-6-7-14(9-13(11)3)16-15(10-18)20-8-4-5-12(2)17(20)19-16/h4-9H,10H2,1-3H3 |
| InChIKey | FXQJVZACJJGAGC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|