C23H26BrF3N4O5 — CID 138516359
tert-butyl N-[1-[[5-[[(2-amino-4-bromophenyl)-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]carbamoyl]cyclopropyl]carbamate (PubChem CID 138516359) has the molecular formula C23H26BrF3N4O5 and a molecular weight of 575.38 g/mol. Its IUPAC name is tert-butyl N-[1-[[5-[[(2-amino-4-bromophenyl)-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]carbamoyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[[5-[[(2-amino-4-bromophenyl)-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]carbamoyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 138516359 |
| Molecular Formula | C23H26BrF3N4O5 |
| Molecular Weight | 575.38 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | tert-butyl N-[1-[[5-[[(2-amino-4-bromophenyl)-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]carbamoyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)Nc2cc(NC(O)c3ccc(Br)cc3N)ccc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C23H26BrF3N4O5/c1-21(2,3)36-20(34)31-22(8-9-22)19(33)30-16-11-13(5-7-17(16)35-23(25,26)27)29-18(32)14-6-4-12(24)10-15(14)28/h4-7,10-11,18,29,32H,8-9,28H2,1-3H3,(H,30,33)(H,31,34) |
| InChIKey | YGRCWFOKIKQHPT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|