C24H27FO6 — CID 138517237
[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorocyclohexyl] 2-methylprop-2-enoate (PubChem CID 138517237) has the molecular formula C24H27FO6 and a molecular weight of 430.47 g/mol. Its IUPAC name is [4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorocyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorocyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138517237 |
| Molecular Formula | C24H27FO6 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorocyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C2CCC(OC(=O)C(=C)C)C(F)C2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C24H27FO6/c1-13(2)22(26)29-19-9-7-16(11-18(19)25)17-8-10-20(30-23(27)14(3)4)21(12-17)31-24(28)15(5)6/h8,10,12,16,18-19H,1,3,5,7,9,11H2,2,4,6H3 |
| InChIKey | MYMRJDJXOQIHOC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|