C27H26O6 — CID 138745030
[5-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate (PubChem CID 138745030) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is [5-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate.
| Compound Name | [5-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138745030 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [5-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc3c(c2)CCC3OC(=O)C(=C)C)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C27H26O6/c1-15(2)25(28)31-22-11-9-20-13-18(7-10-21(20)22)19-8-12-23(32-26(29)16(3)4)24(14-19)33-27(30)17(5)6/h7-8,10,12-14,22H,1,3,5,9,11H2,2,4,6H3 |
| InChIKey | FKEOJKFTVRMBJE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|