C27H25FO6 — CID 138744910
[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-7-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate (PubChem CID 138744910) has the molecular formula C27H25FO6 and a molecular weight of 464.49 g/mol. Its IUPAC name is [4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-7-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-7-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138744910 |
| Molecular Formula | C27H25FO6 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]-7-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)C)c3c2CCC3OC(=O)C(=C)C)cc1F |
| InChI | InChI=1S/C27H25FO6/c1-14(2)25(29)32-21-10-7-17(13-20(21)28)18-8-11-22(33-26(30)15(3)4)24-19(18)9-12-23(24)34-27(31)16(5)6/h7-8,10-11,13,23H,1,3,5,9,12H2,2,4,6H3 |
| InChIKey | YGPANMWFWACMOP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|