C27H26O7 — CID 138744914
[7-[4-methoxy-3-(2-methylprop-2-enoyloxy)phenyl]-3-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate (PubChem CID 138744914) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is [7-[4-methoxy-3-(2-methylprop-2-enoyloxy)phenyl]-3-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate.
| Compound Name | [7-[4-methoxy-3-(2-methylprop-2-enoyloxy)phenyl]-3-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138744914 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [7-[4-methoxy-3-(2-methylprop-2-enoyloxy)phenyl]-3-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC1CCc2c(-c3ccc(OC)c(OC(=O)C(=C)C)c3)ccc(OC(=O)C(=C)C)c21 |
| InChI | InChI=1S/C27H26O7/c1-7-24(28)32-21-13-10-19-18(9-12-22(25(19)21)33-26(29)15(2)3)17-8-11-20(31-6)23(14-17)34-27(30)16(4)5/h7-9,11-12,14,21H,1-2,4,10,13H2,3,5-6H3 |
| InChIKey | FSJXEDJSXSWQMX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|