C22H20O4 — CID 138745445
[7-(4-prop-2-enoyloxyphenyl)-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate (PubChem CID 138745445) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is [7-(4-prop-2-enoyloxyphenyl)-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate.
| Compound Name | [7-(4-prop-2-enoyloxyphenyl)-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138745445 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [7-(4-prop-2-enoyloxyphenyl)-2,3-dihydro-1H-inden-4-yl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)C)c3c2CCC3)cc1 |
| InChI | InChI=1S/C22H20O4/c1-4-21(23)25-16-10-8-15(9-11-16)17-12-13-20(26-22(24)14(2)3)19-7-5-6-18(17)19/h4,8-13H,1-2,5-7H2,3H3 |
| InChIKey | QURSBCWBXOINCX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|