C19H17FO2 — CID 146188899
[4-(7-fluoro-2,3-dihydro-1H-inden-4-yl)phenyl] 2-methylprop-2-enoate (PubChem CID 146188899) has the molecular formula C19H17FO2 and a molecular weight of 296.34 g/mol. Its IUPAC name is [4-(7-fluoro-2,3-dihydro-1H-inden-4-yl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(7-fluoro-2,3-dihydro-1H-inden-4-yl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146188899 |
| Molecular Formula | C19H17FO2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [4-(7-fluoro-2,3-dihydro-1H-inden-4-yl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(F)c3c2CCC3)cc1 |
| InChI | InChI=1S/C19H17FO2/c1-12(2)19(21)22-14-8-6-13(7-9-14)15-10-11-18(20)17-5-3-4-16(15)17/h6-11H,1,3-5H2,2H3 |
| InChIKey | XJBVNWSKIQDMGH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|