C29H30O6 — CID 138744886
[7-(2-methylprop-2-enoyloxy)-4-[4-(3-prop-2-enoyloxypropyl)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate (PubChem CID 138744886) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is [7-(2-methylprop-2-enoyloxy)-4-[4-(3-prop-2-enoyloxypropyl)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate.
| Compound Name | [7-(2-methylprop-2-enoyloxy)-4-[4-(3-prop-2-enoyloxypropyl)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138744886 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [7-(2-methylprop-2-enoyloxy)-4-[4-(3-prop-2-enoyloxypropyl)phenyl]-2,3-dihydro-1H-inden-1-yl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc(-c2ccc(OC(=O)C(=C)C)c3c2CCC3OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C29H30O6/c1-6-26(30)33-17-7-8-20-9-11-21(12-10-20)22-13-15-24(34-28(31)18(2)3)27-23(22)14-16-25(27)35-29(32)19(4)5/h6,9-13,15,25H,1-2,4,7-8,14,16-17H2,3,5H3 |
| InChIKey | QGIPZTWFMMQQRS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|