C26H23FO6 — CID 138744911
[3-fluoro-4-[7-(2-methylprop-2-enoyloxy)-1-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 138744911) has the molecular formula C26H23FO6 and a molecular weight of 450.46 g/mol. Its IUPAC name is [3-fluoro-4-[7-(2-methylprop-2-enoyloxy)-1-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-fluoro-4-[7-(2-methylprop-2-enoyloxy)-1-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138744911 |
| Molecular Formula | C26H23FO6 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [3-fluoro-4-[7-(2-methylprop-2-enoyloxy)-1-prop-2-enoyloxy-2,3-dihydro-1H-inden-4-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC1CCc2c(-c3ccc(OC(=O)C(=C)C)cc3F)ccc(OC(=O)C(=C)C)c21 |
| InChI | InChI=1S/C26H23FO6/c1-6-23(28)32-21-12-10-19-17(9-11-22(24(19)21)33-26(30)15(4)5)18-8-7-16(13-20(18)27)31-25(29)14(2)3/h6-9,11,13,21H,1-2,4,10,12H2,3,5H3 |
| InChIKey | LAKHQOZECNZBOC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|