C20H33NO2 — CID 138519057
4-methoxy-N-[(6-methoxycyclohex-2-en-1-yl)methyl]-N-(3-methylbutyl)cyclohexa-2,4-dien-1-amine (PubChem CID 138519057) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 4-methoxy-N-[(6-methoxycyclohex-2-en-1-yl)methyl]-N-(3-methylbutyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 4-methoxy-N-[(6-methoxycyclohex-2-en-1-yl)methyl]-N-(3-methylbutyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 138519057 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 4-methoxy-N-[(6-methoxycyclohex-2-en-1-yl)methyl]-N-(3-methylbutyl)cyclohexa-2,4-dien-1-amine |
| SMILES | COC1=CCC(N(CCC(C)C)CC2C=CCCC2OC)C=C1 |
| InChI | InChI=1S/C20H33NO2/c1-16(2)13-14-21(18-9-11-19(22-3)12-10-18)15-17-7-5-6-8-20(17)23-4/h5,7,9,11-12,16-18,20H,6,8,10,13-15H2,1-4H3 |
| InChIKey | XQRHMKYADNSRSB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|