C22H29NO3 — CID 163495618
2,4-dimethyl-6-prop-2-enoxy-3-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)-2,4,8,8a-tetrahydro-1,3-benzoxazine (PubChem CID 163495618) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2,4-dimethyl-6-prop-2-enoxy-3-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)-2,4,8,8a-tetrahydro-1,3-benzoxazine.
| Compound Name | 2,4-dimethyl-6-prop-2-enoxy-3-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)-2,4,8,8a-tetrahydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 163495618 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2,4-dimethyl-6-prop-2-enoxy-3-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)-2,4,8,8a-tetrahydro-1,3-benzoxazine |
| SMILES | C=CCOC1=CCC2OC(C)N(C3C=CC(OCC=C)=CC3)C(C)C2=C1 |
| InChI | InChI=1S/C22H29NO3/c1-5-13-24-19-9-7-18(8-10-19)23-16(3)21-15-20(25-14-6-2)11-12-22(21)26-17(23)4/h5-7,9-11,15-18,22H,1-2,8,12-14H2,3-4H3 |
| InChIKey | CQKLDSJONRUZOW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|