C19H25ClN2O2 — CID 138523933
1-(6-chloro-5-methoxy-3-pyridinyl)-3,3-dimethyl-4-phenylmethoxybutan-2-amine (PubChem CID 138523933) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is 1-(6-chloro-5-methoxy-3-pyridinyl)-3,3-dimethyl-4-phenylmethoxybutan-2-amine.
| Compound Name | 1-(6-chloro-5-methoxy-3-pyridinyl)-3,3-dimethyl-4-phenylmethoxybutan-2-amine |
|---|---|
| PubChem CID | 138523933 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-(6-chloro-5-methoxy-3-pyridinyl)-3,3-dimethyl-4-phenylmethoxybutan-2-amine |
| SMILES | COc1cc(CC(N)C(C)(C)COCc2ccccc2)cnc1Cl |
| InChI | InChI=1S/C19H25ClN2O2/c1-19(2,13-24-12-14-7-5-4-6-8-14)17(21)10-15-9-16(23-3)18(20)22-11-15/h4-9,11,17H,10,12-13,21H2,1-3H3 |
| InChIKey | XEVXYNZWIKBONP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|