C20H22N4O3 — CID 153297998
3-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]pyrazine-2,6-diamine (PubChem CID 153297998) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]pyrazine-2,6-diamine.
| Compound Name | 3-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 153297998 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]pyrazine-2,6-diamine |
| SMILES | COc1cc(Cc2ncc(N)nc2N)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C20H22N4O3/c1-25-16-9-14(8-15-20(22)24-18(21)11-23-15)10-17(26-2)19(16)27-12-13-6-4-3-5-7-13/h3-7,9-11H,8,12H2,1-2H3,(H4,21,22,24) |
| InChIKey | XOTXQYJEXCLKBA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |