C13H11BrF5N3O3 — CID 138527009
1-[4-bromo-2-[(trifluoromethoxyamino)diazenyl]phenyl]-4,4-difluoro-2-methylpentane-1,3-dione (PubChem CID 138527009) has the molecular formula C13H11BrF5N3O3 and a molecular weight of 432.14 g/mol. Its IUPAC name is 1-[4-bromo-2-[(trifluoromethoxyamino)diazenyl]phenyl]-4,4-difluoro-2-methylpentane-1,3-dione.
| Compound Name | 1-[4-bromo-2-[(trifluoromethoxyamino)diazenyl]phenyl]-4,4-difluoro-2-methylpentane-1,3-dione |
|---|---|
| PubChem CID | 138527009 |
| Molecular Formula | C13H11BrF5N3O3 |
| Molecular Weight | 432.14 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 1-[4-bromo-2-[(trifluoromethoxyamino)diazenyl]phenyl]-4,4-difluoro-2-methylpentane-1,3-dione |
| SMILES | CC(C(=O)c1ccc(Br)cc1/N=N/NOC(F)(F)F)C(=O)C(C)(F)F |
| InChI | InChI=1S/C13H11BrF5N3O3/c1-6(11(24)12(2,15)16)10(23)8-4-3-7(14)5-9(8)20-21-22-25-13(17,18)19/h3-6H,1-2H3,(H,20,22) |
| InChIKey | DEMJMPGGLKUKLO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.14 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|