C31H34F3N5O2 — CID 138527887
2-[5-[1-(2,4-difluorophenyl)-4-propoxybutyl]-3-(3,5-dimethyltriazol-4-yl)-9-fluoropyrido[3,2-b]indol-7-yl]propan-2-ol (PubChem CID 138527887) has the molecular formula C31H34F3N5O2 and a molecular weight of 565.64 g/mol. Its IUPAC name is 2-[5-[1-(2,4-difluorophenyl)-4-propoxybutyl]-3-(3,5-dimethyltriazol-4-yl)-9-fluoropyrido[3,2-b]indol-7-yl]propan-2-ol.
| Compound Name | 2-[5-[1-(2,4-difluorophenyl)-4-propoxybutyl]-3-(3,5-dimethyltriazol-4-yl)-9-fluoropyrido[3,2-b]indol-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 138527887 |
| Molecular Formula | C31H34F3N5O2 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 2-[5-[1-(2,4-difluorophenyl)-4-propoxybutyl]-3-(3,5-dimethyltriazol-4-yl)-9-fluoropyrido[3,2-b]indol-7-yl]propan-2-ol |
| SMILES | CCCOCCCC(c1ccc(F)cc1F)n1c2cc(-c3c(C)nnn3C)cnc2c2c(F)cc(C(C)(C)O)cc21 |
| InChI | InChI=1S/C31H34F3N5O2/c1-6-11-41-12-7-8-25(22-10-9-21(32)16-23(22)33)39-26-15-20(31(3,4)40)14-24(34)28(26)29-27(39)13-19(17-35-29)30-18(2)36-37-38(30)5/h9-10,13-17,25,40H,6-8,11-12H2,1-5H3 |
| InChIKey | LUVYXLULFPFNOT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|