C17H31NS — CID 138528345
(E,4R)-6-[(Z)-1-but-1-en-2-ylsulfanylprop-1-enyl]-4-methylnon-6-en-2-amine (PubChem CID 138528345) has the molecular formula C17H31NS and a molecular weight of 281.51 g/mol. Its IUPAC name is (E,4R)-6-[(Z)-1-but-1-en-2-ylsulfanylprop-1-enyl]-4-methylnon-6-en-2-amine.
| Compound Name | (E,4R)-6-[(Z)-1-but-1-en-2-ylsulfanylprop-1-enyl]-4-methylnon-6-en-2-amine |
|---|---|
| PubChem CID | 138528345 |
| Molecular Formula | C17H31NS |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | (E,4R)-6-[(Z)-1-but-1-en-2-ylsulfanylprop-1-enyl]-4-methylnon-6-en-2-amine |
| SMILES | C=C(CC)SC(=C\C)/C(=C/CC)C[C@@H](C)CC(C)N |
| InChI | InChI=1S/C17H31NS/c1-7-10-16(12-13(4)11-14(5)18)17(9-3)19-15(6)8-2/h9-10,13-14H,6-8,11-12,18H2,1-5H3/b16-10+,17-9-/t13-,14?/m0/s1 |
| InChIKey | VTRISCOTBGPVER-JBSKOUOUSA-N |
| XLogP | 5.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|