C17H29NS — CID 143954790
(4E,6E)-6-(cyclopentylmethylsulfanyl)-4-ethylnona-4,6,8-trien-1-amine (PubChem CID 143954790) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is (4E,6E)-6-(cyclopentylmethylsulfanyl)-4-ethylnona-4,6,8-trien-1-amine.
| Compound Name | (4E,6E)-6-(cyclopentylmethylsulfanyl)-4-ethylnona-4,6,8-trien-1-amine |
|---|---|
| PubChem CID | 143954790 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (4E,6E)-6-(cyclopentylmethylsulfanyl)-4-ethylnona-4,6,8-trien-1-amine |
| SMILES | C=C/C=C(\C=C(/CC)CCCN)SCC1CCCC1 |
| InChI | InChI=1S/C17H29NS/c1-3-8-17(13-15(4-2)11-7-12-18)19-14-16-9-5-6-10-16/h3,8,13,16H,1,4-7,9-12,14,18H2,2H3/b15-13+,17-8+ |
| InChIKey | ZICUQAIFZQYLHT-SFFIYBTHSA-N |
| XLogP | 5.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|