C16H26N2O3 — CID 138528746
ethyl (2Z,4E)-2-cyano-5-(3-methoxypropylamino)-3-propylhexa-2,4-dienoate (PubChem CID 138528746) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-cyano-5-(3-methoxypropylamino)-3-propylhexa-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-2-cyano-5-(3-methoxypropylamino)-3-propylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 138528746 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | ethyl (2Z,4E)-2-cyano-5-(3-methoxypropylamino)-3-propylhexa-2,4-dienoate |
| SMILES | CCCC(/C=C(\C)NCCCOC)=C(\C#N)C(=O)OCC |
| InChI | InChI=1S/C16H26N2O3/c1-5-8-14(15(12-17)16(19)21-6-2)11-13(3)18-9-7-10-20-4/h11,18H,5-10H2,1-4H3/b13-11+,15-14- |
| InChIKey | BQAWMXIDKQUPJI-RZVDUMMSSA-N |
| XLogP | 2.70 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|