C18H30N2O4 — CID 163650725
2-ethoxyethyl (2Z)-2-cyano-7-(3-methoxypropylamino)-3-methylocta-2,7-dienoate (PubChem CID 163650725) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-ethoxyethyl (2Z)-2-cyano-7-(3-methoxypropylamino)-3-methylocta-2,7-dienoate.
| Compound Name | 2-ethoxyethyl (2Z)-2-cyano-7-(3-methoxypropylamino)-3-methylocta-2,7-dienoate |
|---|---|
| PubChem CID | 163650725 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-ethoxyethyl (2Z)-2-cyano-7-(3-methoxypropylamino)-3-methylocta-2,7-dienoate |
| SMILES | C=C(CCC/C(C)=C(/C#N)C(=O)OCCOCC)NCCCOC |
| InChI | InChI=1S/C18H30N2O4/c1-5-23-12-13-24-18(21)17(14-19)15(2)8-6-9-16(3)20-10-7-11-22-4/h20H,3,5-13H2,1-2,4H3/b17-15- |
| InChIKey | IMAGFNKWHZTIIJ-ICFOKQHNSA-N |
| XLogP | 2.72 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|