C27H44O4 — CID 138529468
3-(methoxymethyl)-6-[4-[(Z)-2-(4-pentylphenoxy)ethenoxy]cyclohexyl]hexan-1-ol (PubChem CID 138529468) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 3-(methoxymethyl)-6-[4-[(Z)-2-(4-pentylphenoxy)ethenoxy]cyclohexyl]hexan-1-ol.
| Compound Name | 3-(methoxymethyl)-6-[4-[(Z)-2-(4-pentylphenoxy)ethenoxy]cyclohexyl]hexan-1-ol |
|---|---|
| PubChem CID | 138529468 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 3-(methoxymethyl)-6-[4-[(Z)-2-(4-pentylphenoxy)ethenoxy]cyclohexyl]hexan-1-ol |
| SMILES | CCCCCc1ccc(O/C=C\OC2CCC(CCCC(CCO)COC)CC2)cc1 |
| InChI | InChI=1S/C27H44O4/c1-3-4-5-7-23-10-14-26(15-11-23)30-20-21-31-27-16-12-24(13-17-27)8-6-9-25(18-19-28)22-29-2/h10-11,14-15,20-21,24-25,27-28H,3-9,12-13,16-19,22H2,1-2H3/b21-20- |
| InChIKey | XVPHQIMMYKMYKX-MRCUWXFGSA-N |
| XLogP | 6.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|