C42H68O2 — CID 138529774
[4,7,8-trimethyl-9-[2-methyl-4-[2-[4-(4-pentylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]ethyl]cyclohexyl]nonyl] 2-methylprop-2-enoate (PubChem CID 138529774) has the molecular formula C42H68O2 and a molecular weight of 605.00 g/mol. Its IUPAC name is [4,7,8-trimethyl-9-[2-methyl-4-[2-[4-(4-pentylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]ethyl]cyclohexyl]nonyl] 2-methylprop-2-enoate.
| Compound Name | [4,7,8-trimethyl-9-[2-methyl-4-[2-[4-(4-pentylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]ethyl]cyclohexyl]nonyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138529774 |
| Molecular Formula | C42H68O2 |
| Molecular Weight | 605.00 g/mol |
| Exact Mass | 604.52 |
| IUPAC Name | [4,7,8-trimethyl-9-[2-methyl-4-[2-[4-(4-pentylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]ethyl]cyclohexyl]nonyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(C)CCC(C)C(C)CC1CCC(CCC2=CC=C(C3=CC=C(CCCCC)CC3)CC2)CC1C |
| InChI | InChI=1S/C42H68O2/c1-8-9-10-13-36-18-23-39(24-19-36)40-25-20-37(21-26-40)16-17-38-22-27-41(35(7)29-38)30-34(6)33(5)15-14-32(4)12-11-28-44-42(43)31(2)3/h18,20,23,25,32-35,38,41H,2,8-17,19,21-22,24,26-30H2,1,3-7H3 |
| InChIKey | QUZSKYHDYKEGMO-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.00 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|