C27H29Cl2N7O3S2 — CID 138530604
3-(2,6-dichlorophenyl)-7-[4-piperazin-1-yl-3-(pyrrolidin-1-ylsulfonylmethyl)anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 138530604) has the molecular formula C27H29Cl2N7O3S2 and a molecular weight of 634.62 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-piperazin-1-yl-3-(pyrrolidin-1-ylsulfonylmethyl)anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-piperazin-1-yl-3-(pyrrolidin-1-ylsulfonylmethyl)anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 138530604 |
| Molecular Formula | C27H29Cl2N7O3S2 |
| Molecular Weight | 634.62 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-piperazin-1-yl-3-(pyrrolidin-1-ylsulfonylmethyl)anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | O=C1c2cnc(Nc3ccc(N4CCNCC4)c(CS(=O)(=O)N4CCCC4)c3)nc2SCN1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H29Cl2N7O3S2/c28-21-4-3-5-22(29)24(21)36-17-40-25-20(26(36)37)15-31-27(33-25)32-19-6-7-23(34-12-8-30-9-13-34)18(14-19)16-41(38,39)35-10-1-2-11-35/h3-7,14-15,30H,1-2,8-13,16-17H2,(H,31,32,33) |
| InChIKey | DQPMMYPPRMXJIC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|