C6H9NOS2 — CID 138532116
5-ethylsulfinyl-4-methyl-1,3-thiazole (PubChem CID 138532116) has the molecular formula C6H9NOS2 and a molecular weight of 175.28 g/mol. Its IUPAC name is 5-ethylsulfinyl-4-methyl-1,3-thiazole.
| Compound Name | 5-ethylsulfinyl-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 138532116 |
| Molecular Formula | C6H9NOS2 |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | 5-ethylsulfinyl-4-methyl-1,3-thiazole |
| SMILES | CCS(=O)c1scnc1C |
| InChI | InChI=1S/C6H9NOS2/c1-3-10(8)6-5(2)7-4-9-6/h4H,3H2,1-2H3 |
| InChIKey | HCUKQOHHEKPPPW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |