C7H8N2O2S — CID 175083454
N-(4-methyl-1,3-thiazol-5-yl)-3-oxopropanamide (PubChem CID 175083454) has the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-5-yl)-3-oxopropanamide.
| Compound Name | N-(4-methyl-1,3-thiazol-5-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 175083454 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-5-yl)-3-oxopropanamide |
| SMILES | Cc1ncsc1NC(=O)CC=O |
| InChI | InChI=1S/C7H8N2O2S/c1-5-7(12-4-8-5)9-6(11)2-3-10/h3-4H,2H2,1H3,(H,9,11) |
| InChIKey | ULNOLAYRMHYFBL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|