C8H10N2O3S — CID 20848632
3-[formyl-(4-methyl-1,3-thiazol-5-yl)amino]propanoic acid (PubChem CID 20848632) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-[formyl-(4-methyl-1,3-thiazol-5-yl)amino]propanoic acid.
| Compound Name | 3-[formyl-(4-methyl-1,3-thiazol-5-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 20848632 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-[formyl-(4-methyl-1,3-thiazol-5-yl)amino]propanoic acid |
| SMILES | Cc1ncsc1N(C=O)CCC(=O)O |
| InChI | InChI=1S/C8H10N2O3S/c1-6-8(14-4-9-6)10(5-11)3-2-7(12)13/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | ZIERHHKABPIMQK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|