C8H8IN5OS — CID 143899936
1-(1-iodopyrazol-4-yl)-3-(4-methyl-1,3-thiazol-5-yl)urea (PubChem CID 143899936) has the molecular formula C8H8IN5OS and a molecular weight of 349.16 g/mol. Its IUPAC name is 1-(1-iodopyrazol-4-yl)-3-(4-methyl-1,3-thiazol-5-yl)urea.
| Compound Name | 1-(1-iodopyrazol-4-yl)-3-(4-methyl-1,3-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 143899936 |
| Molecular Formula | C8H8IN5OS |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 1-(1-iodopyrazol-4-yl)-3-(4-methyl-1,3-thiazol-5-yl)urea |
| SMILES | Cc1ncsc1NC(=O)Nc1cnn(I)c1 |
| InChI | InChI=1S/C8H8IN5OS/c1-5-7(16-4-10-5)13-8(15)12-6-2-11-14(9)3-6/h2-4H,1H3,(H2,12,13,15) |
| InChIKey | FMCIHQLYBJNTLE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|