C29H31FN4O11 — CID 138532333
hydroxymethyl (2R)-4-[2-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-hydroperoxy-1-hydroxyindol-3-yl]-2-oxoacetyl]-2,5-dihydroxypiperazine-1-carboxylate (PubChem CID 138532333) has the molecular formula C29H31FN4O11 and a molecular weight of 630.58 g/mol. Its IUPAC name is hydroxymethyl (2R)-4-[2-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-hydroperoxy-1-hydroxyindol-3-yl]-2-oxoacetyl]-2,5-dihydroxypiperazine-1-carboxylate.
| Compound Name | hydroxymethyl (2R)-4-[2-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-hydroperoxy-1-hydroxyindol-3-yl]-2-oxoacetyl]-2,5-dihydroxypiperazine-1-carboxylate |
|---|---|
| PubChem CID | 138532333 |
| Molecular Formula | C29H31FN4O11 |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | hydroxymethyl (2R)-4-[2-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-hydroperoxy-1-hydroxyindol-3-yl]-2-oxoacetyl]-2,5-dihydroxypiperazine-1-carboxylate |
| SMILES | O=C(C(=O)N1C[C@@H](O)N(C(=O)OCO)CC1O)c1cn(O)c2cc(OO)c(C(=O)N3CCC(Cc4ccc(F)cc4)CC3)cc12 |
| InChI | InChI=1S/C29H31FN4O11/c30-18-3-1-16(2-4-18)9-17-5-7-31(8-6-17)27(39)20-10-19-21(12-34(42)22(19)11-23(20)45-43)26(38)28(40)32-13-25(37)33(14-24(32)36)29(41)44-15-35/h1-4,10-12,17,24-25,35-37,42-43H,5-9,13-15H2/t24?,25-/m1/s1 |
| InChIKey | JEQNQXZXJIAJGB-WUBHUQEYSA-N |
| XLogP | 1.01 |
| TPSA | 202.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|