C28H29F3N2O4 — CID 138532512
1,2-dimethyl-6-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-4-(2,3,5-trifluoro-4-methylphenyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 138532512) has the molecular formula C28H29F3N2O4 and a molecular weight of 514.54 g/mol. Its IUPAC name is 1,2-dimethyl-6-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-4-(2,3,5-trifluoro-4-methylphenyl)-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1,2-dimethyl-6-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-4-(2,3,5-trifluoro-4-methylphenyl)-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 138532512 |
| Molecular Formula | C28H29F3N2O4 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 1,2-dimethyl-6-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-4-(2,3,5-trifluoro-4-methylphenyl)-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cc(F)c(C)c(F)c2F)C(C(=O)O)=C(CCN2CCc3ccccc3CC2)N1C |
| InChI | InChI=1S/C28H29F3N2O4/c1-15-20(29)14-19(26(31)25(15)30)23-22(27(34)35)16(2)32(3)21(24(23)28(36)37)10-13-33-11-8-17-6-4-5-7-18(17)9-12-33/h4-7,14,23H,8-13H2,1-3H3,(H,34,35)(H,36,37) |
| InChIKey | SEGDRQUVYKJYPY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|