C33H35F3N2O8 — CID 158743302
(E)-3-formyloxyprop-2-enoic acid;methyl 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-(formyloxymethyl)-1,6-dimethyl-4-[4-(trifluoromethyl)phenyl]-4H-pyridine-3-carboxylate (PubChem CID 158743302) has the molecular formula C33H35F3N2O8 and a molecular weight of 644.64 g/mol. Its IUPAC name is (E)-3-formyloxyprop-2-enoic acid;methyl 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-(formyloxymethyl)-1,6-dimethyl-4-[4-(trifluoromethyl)phenyl]-4H-pyridine-3-carboxylate.
| Compound Name | (E)-3-formyloxyprop-2-enoic acid;methyl 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-(formyloxymethyl)-1,6-dimethyl-4-[4-(trifluoromethyl)phenyl]-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158743302 |
| Molecular Formula | C33H35F3N2O8 |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | (E)-3-formyloxyprop-2-enoic acid;methyl 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-(formyloxymethyl)-1,6-dimethyl-4-[4-(trifluoromethyl)phenyl]-4H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(CCN2CCc3ccccc3C2)N(C)C(C)=C(COC=O)C1c1ccc(C(F)(F)F)cc1.O=CO/C=C/C(=O)O |
| InChI | InChI=1S/C29H31F3N2O4.C4H4O4/c1-19-24(17-38-18-35)26(21-8-10-23(11-9-21)29(30,31)32)27(28(36)37-3)25(33(19)2)13-15-34-14-12-20-6-4-5-7-22(20)16-34;5-3-8-2-1-4(6)7/h4-11,18,26H,12-17H2,1-3H3;1-3H,(H,6,7)/b;2-1+ |
| InChIKey | IMOOWBVXOADPGA-WLHGVMLRSA-N |
| XLogP | 4.81 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|