C19H19NO5 — CID 138534037
methyl (3R)-3-(hydroxymethyl)-7-(methylcarbamoyl)-3-phenyl-2H-1-benzofuran-5-carboxylate (PubChem CID 138534037) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl (3R)-3-(hydroxymethyl)-7-(methylcarbamoyl)-3-phenyl-2H-1-benzofuran-5-carboxylate.
| Compound Name | methyl (3R)-3-(hydroxymethyl)-7-(methylcarbamoyl)-3-phenyl-2H-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 138534037 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl (3R)-3-(hydroxymethyl)-7-(methylcarbamoyl)-3-phenyl-2H-1-benzofuran-5-carboxylate |
| SMILES | CNC(=O)c1cc(C(=O)OC)cc2c1OC[C@]2(CO)c1ccccc1 |
| InChI | InChI=1S/C19H19NO5/c1-20-17(22)14-8-12(18(23)24-2)9-15-16(14)25-11-19(15,10-21)13-6-4-3-5-7-13/h3-9,21H,10-11H2,1-2H3,(H,20,22)/t19-/m1/s1 |
| InChIKey | WZGBIZDZPNSINE-LJQANCHMSA-N |
| XLogP | 1.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |