C25H31N3O5 — CID 155118863
(3S)-5-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide (PubChem CID 155118863) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (3S)-5-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide.
| Compound Name | (3S)-5-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 155118863 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (3S)-5-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCC2OCC(N)CO2)cc2c1OC[C@@]2(C)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O5/c1-25(17-7-4-3-5-8-17)15-33-22-19(24(30)27-2)11-16(12-20(22)25)23(29)28-10-6-9-21-31-13-18(26)14-32-21/h3-5,7-8,11-12,18,21H,6,9-10,13-15,26H2,1-2H3,(H,27,30)(H,28,29)/t18?,21?,25-/m0/s1 |
| InChIKey | GUQOHMJZRRKINT-JUWHTYBZSA-N |
| XLogP | 1.95 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|