C21H31N5O3 — CID 167262854
N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-3-(methylaminomethyl)-1-(1-phenylethyl)pyrazole-5-carboxamide (PubChem CID 167262854) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-3-(methylaminomethyl)-1-(1-phenylethyl)pyrazole-5-carboxamide.
| Compound Name | N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-3-(methylaminomethyl)-1-(1-phenylethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167262854 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-3-(methylaminomethyl)-1-(1-phenylethyl)pyrazole-5-carboxamide |
| SMILES | CNCc1cc(C(=O)NCCCC2OCC(N)CO2)n(C(C)c2ccccc2)n1 |
| InChI | InChI=1S/C21H31N5O3/c1-15(16-7-4-3-5-8-16)26-19(11-18(25-26)12-23-2)21(27)24-10-6-9-20-28-13-17(22)14-29-20/h3-5,7-8,11,15,17,20,23H,6,9-10,12-14,22H2,1-2H3,(H,24,27) |
| InChIKey | WGMKDZIWVZAGGQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|