C32H31N3O7 — CID 155100491
5-N-[2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]ethyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide (PubChem CID 155100491) has the molecular formula C32H31N3O7 and a molecular weight of 569.61 g/mol. Its IUPAC name is 5-N-[2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]ethyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide.
| Compound Name | 5-N-[2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]ethyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 155100491 |
| Molecular Formula | C32H31N3O7 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 5-N-[2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]ethyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCC2OCC(N3C(=O)c4ccccc4C3=O)CO2)cc2c1OCC2(C)c1ccccc1 |
| InChI | InChI=1S/C32H31N3O7/c1-32(20-8-4-3-5-9-20)18-42-27-24(29(37)33-2)14-19(15-25(27)32)28(36)34-13-12-26-40-16-21(17-41-26)35-30(38)22-10-6-7-11-23(22)31(35)39/h3-11,14-15,21,26H,12-13,16-18H2,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | KNSXFYNYNFTUTL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|