C20H28N6O3 — CID 138535443
3-amino-4-[[5-[4-carbamoyl-2-(hydroxyamino)anilino]-2-methylpentan-2-yl]amino]benzamide (PubChem CID 138535443) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-amino-4-[[5-[4-carbamoyl-2-(hydroxyamino)anilino]-2-methylpentan-2-yl]amino]benzamide.
| Compound Name | 3-amino-4-[[5-[4-carbamoyl-2-(hydroxyamino)anilino]-2-methylpentan-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 138535443 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3-amino-4-[[5-[4-carbamoyl-2-(hydroxyamino)anilino]-2-methylpentan-2-yl]amino]benzamide |
| SMILES | CC(C)(CCCNc1ccc(C(N)=O)cc1NO)Nc1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C20H28N6O3/c1-20(2,25-15-6-4-12(18(22)27)10-14(15)21)8-3-9-24-16-7-5-13(19(23)28)11-17(16)26-29/h4-7,10-11,24-26,29H,3,8-9,21H2,1-2H3,(H2,22,27)(H2,23,28) |
| InChIKey | VCSIPEIRZBZIAW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 168.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|