C15H16FN3O — CID 138543277
[(1R,2R)-2-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]cyclopropyl]methanol (PubChem CID 138543277) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is [(1R,2R)-2-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]cyclopropyl]methanol.
| Compound Name | [(1R,2R)-2-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 138543277 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [(1R,2R)-2-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]cyclopropyl]methanol |
| SMILES | OC[C@@H]1C[C@H]1c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F |
| InChI | InChI=1S/C15H16FN3O/c16-12-7-13(9-4-2-1-3-5-9)19-15(12)17-14(18-19)11-6-10(11)8-20/h1-5,10-13,20H,6-8H2/t10-,11+,12-,13-/m0/s1 |
| InChIKey | AMWBTOPVUJOAKN-RNJOBUHISA-N |
| XLogP | 2.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |