C29H39N5O4S — CID 138544401
4-[2-[[(2S)-heptan-2-yl]amino]-5-(4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one (PubChem CID 138544401) has the molecular formula C29H39N5O4S and a molecular weight of 553.73 g/mol. Its IUPAC name is 4-[2-[[(2S)-heptan-2-yl]amino]-5-(4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one.
| Compound Name | 4-[2-[[(2S)-heptan-2-yl]amino]-5-(4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 138544401 |
| Molecular Formula | C29H39N5O4S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 4-[2-[[(2S)-heptan-2-yl]amino]-5-(4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one |
| SMILES | CCCCC[C@H](C)Nc1ncc2c(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)cc(C3CCC(=O)CC3)n2n1 |
| InChI | InChI=1S/C29H39N5O4S/c1-3-4-5-6-21(2)31-29-30-20-28-26(19-27(34(28)32-29)23-7-11-24(35)12-8-23)22-9-13-25(14-10-22)39(36,37)33-15-17-38-18-16-33/h9-10,13-14,19-21,23H,3-8,11-12,15-18H2,1-2H3,(H,31,32)/t21-/m0/s1 |
| InChIKey | OKXWZNZYZOXDDG-NRFANRHFSA-N |
| XLogP | 5.02 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|