C37H50BrCl2N5O3 — CID 138546766
(E)-N-(4-bromo-2,6-dichloro-3,5-dimethoxyphenyl)-2-[(E)-4-[(Z)-but-1-enyl]imino-4-[4-[(4-ethylpiperazin-1-yl)methyl]anilino]-3-methylbut-2-en-2-yl]hept-2-enamide (PubChem CID 138546766) has the molecular formula C37H50BrCl2N5O3 and a molecular weight of 763.65 g/mol. Its IUPAC name is (E)-N-(4-bromo-2,6-dichloro-3,5-dimethoxyphenyl)-2-[(E)-4-[(Z)-but-1-enyl]imino-4-[4-[(4-ethylpiperazin-1-yl)methyl]anilino]-3-methylbut-2-en-2-yl]hept-2-enamide.
| Compound Name | (E)-N-(4-bromo-2,6-dichloro-3,5-dimethoxyphenyl)-2-[(E)-4-[(Z)-but-1-enyl]imino-4-[4-[(4-ethylpiperazin-1-yl)methyl]anilino]-3-methylbut-2-en-2-yl]hept-2-enamide |
|---|---|
| PubChem CID | 138546766 |
| Molecular Formula | C37H50BrCl2N5O3 |
| Molecular Weight | 763.65 g/mol |
| Exact Mass | 761.25 |
| IUPAC Name | (E)-N-(4-bromo-2,6-dichloro-3,5-dimethoxyphenyl)-2-[(E)-4-[(Z)-but-1-enyl]imino-4-[4-[(4-ethylpiperazin-1-yl)methyl]anilino]-3-methylbut-2-en-2-yl]hept-2-enamide |
| SMILES | CC/C=C\N=C(Nc1ccc(CN2CCN(CC)CC2)cc1)\C(C)=C(C)\C(=C/CCCC)C(=O)Nc1c(Cl)c(OC)c(Br)c(OC)c1Cl |
| InChI | InChI=1S/C37H50BrCl2N5O3/c1-8-11-13-14-29(37(46)43-33-31(39)34(47-6)30(38)35(48-7)32(33)40)25(4)26(5)36(41-19-12-9-2)42-28-17-15-27(16-18-28)24-45-22-20-44(10-3)21-23-45/h12,14-19H,8-11,13,20-24H2,1-7H3,(H,41,42)(H,43,46)/b19-12-,26-25+,29-14+ |
| InChIKey | WOTSIHNNHZSNBA-WRIQFBGQSA-N |
| XLogP | 9.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.65 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|