C34H51ClFN3O3S — CID 138547152
(3S)-3-(4-chlorophenyl)-N-[2-[3-[[3-(ethylamino)-6-hydroxysulfanylhexyl]amino]butyl]-3-fluorophenyl]-5-(oxan-2-yl)pentanamide (PubChem CID 138547152) has the molecular formula C34H51ClFN3O3S and a molecular weight of 636.32 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-N-[2-[3-[[3-(ethylamino)-6-hydroxysulfanylhexyl]amino]butyl]-3-fluorophenyl]-5-(oxan-2-yl)pentanamide.
| Compound Name | (3S)-3-(4-chlorophenyl)-N-[2-[3-[[3-(ethylamino)-6-hydroxysulfanylhexyl]amino]butyl]-3-fluorophenyl]-5-(oxan-2-yl)pentanamide |
|---|---|
| PubChem CID | 138547152 |
| Molecular Formula | C34H51ClFN3O3S |
| Molecular Weight | 636.32 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-N-[2-[3-[[3-(ethylamino)-6-hydroxysulfanylhexyl]amino]butyl]-3-fluorophenyl]-5-(oxan-2-yl)pentanamide |
| SMILES | CCNC(CCCSO)CCNC(C)CCc1c(F)cccc1NC(=O)C[C@H](CCC1CCCCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H51ClFN3O3S/c1-3-37-29(8-7-23-43-41)20-21-38-25(2)12-19-31-32(36)10-6-11-33(31)39-34(40)24-27(26-13-16-28(35)17-14-26)15-18-30-9-4-5-22-42-30/h6,10-11,13-14,16-17,25,27,29-30,37-38,41H,3-5,7-9,12,15,18-24H2,1-2H3,(H,39,40)/t25?,27-,29?,30?/m0/s1 |
| InChIKey | RSKHRDYVPBRTKF-PCXNLJOPSA-N |
| XLogP | 8.21 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.32 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|