C29H37F2N3O2S — CID 138547207
3-(4-fluorophenyl)-N-[3-fluoro-2-[2-[(6R)-2-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]phenyl]-3-(oxan-2-yl)propanamide (PubChem CID 138547207) has the molecular formula C29H37F2N3O2S and a molecular weight of 529.70 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[3-fluoro-2-[2-[(6R)-2-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]phenyl]-3-(oxan-2-yl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[3-fluoro-2-[2-[(6R)-2-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]phenyl]-3-(oxan-2-yl)propanamide |
|---|---|
| PubChem CID | 138547207 |
| Molecular Formula | C29H37F2N3O2S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[3-fluoro-2-[2-[(6R)-2-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]phenyl]-3-(oxan-2-yl)propanamide |
| SMILES | O=C(CC(c1ccc(F)cc1)C1CCCCO1)Nc1cccc(F)c1CCC1CN[C@@H]2CCCSN1C2 |
| InChI | InChI=1S/C29H37F2N3O2S/c30-21-11-9-20(10-12-21)25(28-8-1-2-15-36-28)17-29(35)33-27-7-3-6-26(31)24(27)14-13-23-18-32-22-5-4-16-37-34(23)19-22/h3,6-7,9-12,22-23,25,28,32H,1-2,4-5,8,13-19H2,(H,33,35)/t22-,23?,25?,28?/m1/s1 |
| InChIKey | ZORMJVFUENIPQI-ZGYBPFETSA-N |
| XLogP | 5.66 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|