C29H39F2N3O2S — CID 138547206
3-(4-fluorophenyl)-N-[3-fluoro-2-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]phenyl]-3-(oxan-3-yl)propanamide (PubChem CID 138547206) has the molecular formula C29H39F2N3O2S and a molecular weight of 531.71 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[3-fluoro-2-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]phenyl]-3-(oxan-3-yl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[3-fluoro-2-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]phenyl]-3-(oxan-3-yl)propanamide |
|---|---|
| PubChem CID | 138547206 |
| Molecular Formula | C29H39F2N3O2S |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[3-fluoro-2-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]phenyl]-3-(oxan-3-yl)propanamide |
| SMILES | CCCSN1CCNCC1CCc1c(F)cccc1NC(=O)CC(c1ccc(F)cc1)C1CCCOC1 |
| InChI | InChI=1S/C29H39F2N3O2S/c1-2-17-37-34-15-14-32-19-24(34)12-13-25-27(31)6-3-7-28(25)33-29(35)18-26(22-5-4-16-36-20-22)21-8-10-23(30)11-9-21/h3,6-11,22,24,26,32H,2,4-5,12-20H2,1H3,(H,33,35) |
| InChIKey | FQGOCLHEKYEPII-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|