C15H23FN4OS — CID 138547115
N-[5-fluoro-4-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]-3-pyridinyl]formamide (PubChem CID 138547115) has the molecular formula C15H23FN4OS and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[5-fluoro-4-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]-3-pyridinyl]formamide.
| Compound Name | N-[5-fluoro-4-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 138547115 |
| Molecular Formula | C15H23FN4OS |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[5-fluoro-4-[2-(1-propylsulfanylpiperazin-2-yl)ethyl]-3-pyridinyl]formamide |
| SMILES | CCCSN1CCNCC1CCc1c(F)cncc1NC=O |
| InChI | InChI=1S/C15H23FN4OS/c1-2-7-22-20-6-5-17-8-12(20)3-4-13-14(16)9-18-10-15(13)19-11-21/h9-12,17H,2-8H2,1H3,(H,19,21) |
| InChIKey | YBINUJRKYPHZCI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|