C28H38F2N4O2S — CID 138547249
3-(4-fluorophenyl)-N-[5-fluoro-4-[2-[(2S)-1-propylsulfanylpiperazin-2-yl]ethyl]-3-pyridinyl]-3-(oxan-4-yl)propanamide (PubChem CID 138547249) has the molecular formula C28H38F2N4O2S and a molecular weight of 532.70 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[5-fluoro-4-[2-[(2S)-1-propylsulfanylpiperazin-2-yl]ethyl]-3-pyridinyl]-3-(oxan-4-yl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[5-fluoro-4-[2-[(2S)-1-propylsulfanylpiperazin-2-yl]ethyl]-3-pyridinyl]-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 138547249 |
| Molecular Formula | C28H38F2N4O2S |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[5-fluoro-4-[2-[(2S)-1-propylsulfanylpiperazin-2-yl]ethyl]-3-pyridinyl]-3-(oxan-4-yl)propanamide |
| SMILES | CCCSN1CCNC[C@@H]1CCc1c(F)cncc1NC(=O)CC(c1ccc(F)cc1)C1CCOCC1 |
| InChI | InChI=1S/C28H38F2N4O2S/c1-2-15-37-34-12-11-31-17-23(34)7-8-24-26(30)18-32-19-27(24)33-28(35)16-25(21-9-13-36-14-10-21)20-3-5-22(29)6-4-20/h3-6,18-19,21,23,25,31H,2,7-17H2,1H3,(H,33,35)/t23-,25?/m0/s1 |
| InChIKey | YORLSXPOLNHGSC-LFQPHHBNSA-N |
| XLogP | 5.16 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|