C29H48ClN3O2S — CID 144921246
3-(4-chlorophenyl)-N-cyclohexyl-3-(oxan-4-yl)propanamide;2-ethyl-1-propylsulfanylpiperazine (PubChem CID 144921246) has the molecular formula C29H48ClN3O2S and a molecular weight of 538.24 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-cyclohexyl-3-(oxan-4-yl)propanamide;2-ethyl-1-propylsulfanylpiperazine.
| Compound Name | 3-(4-chlorophenyl)-N-cyclohexyl-3-(oxan-4-yl)propanamide;2-ethyl-1-propylsulfanylpiperazine |
|---|---|
| PubChem CID | 144921246 |
| Molecular Formula | C29H48ClN3O2S |
| Molecular Weight | 538.24 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 3-(4-chlorophenyl)-N-cyclohexyl-3-(oxan-4-yl)propanamide;2-ethyl-1-propylsulfanylpiperazine |
| SMILES | CCCSN1CCNCC1CC.O=C(CC(c1ccc(Cl)cc1)C1CCOCC1)NC1CCCCC1 |
| InChI | InChI=1S/C20H28ClNO2.C9H20N2S/c21-17-8-6-15(7-9-17)19(16-10-12-24-13-11-16)14-20(23)22-18-4-2-1-3-5-18;1-3-7-12-11-6-5-10-8-9(11)4-2/h6-9,16,18-19H,1-5,10-14H2,(H,22,23);9-10H,3-8H2,1-2H3 |
| InChIKey | JOCGPVCFOUTMRN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.24 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|