C20H33FN4O2S — CID 144917370
tert-butyl 3-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]-4-propylsulfanylpiperazine-1-carboxylate (PubChem CID 144917370) has the molecular formula C20H33FN4O2S and a molecular weight of 412.58 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]-4-propylsulfanylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]-4-propylsulfanylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 144917370 |
| Molecular Formula | C20H33FN4O2S |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | tert-butyl 3-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]-4-propylsulfanylpiperazine-1-carboxylate |
| SMILES | CCCSN1CCN(C(=O)OC(C)(C)C)CC1CCc1c(F)cncc1NC |
| InChI | InChI=1S/C20H33FN4O2S/c1-6-11-28-25-10-9-24(19(26)27-20(2,3)4)14-15(25)7-8-16-17(21)12-23-13-18(16)22-5/h12-13,15,22H,6-11,14H2,1-5H3 |
| InChIKey | NEASLIQRSHDHCR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|