C16H26Br2N2O2S — CID 144917360
acetylene;tert-butyl (3S)-3-(2,2-dibromoethenyl)-4-propylsulfanylpiperazine-1-carboxylate (PubChem CID 144917360) has the molecular formula C16H26Br2N2O2S and a molecular weight of 470.27 g/mol. Its IUPAC name is acetylene;tert-butyl (3S)-3-(2,2-dibromoethenyl)-4-propylsulfanylpiperazine-1-carboxylate.
| Compound Name | acetylene;tert-butyl (3S)-3-(2,2-dibromoethenyl)-4-propylsulfanylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 144917360 |
| Molecular Formula | C16H26Br2N2O2S |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | acetylene;tert-butyl (3S)-3-(2,2-dibromoethenyl)-4-propylsulfanylpiperazine-1-carboxylate |
| SMILES | C#C.CCCSN1CCN(C(=O)OC(C)(C)C)C[C@@H]1C=C(Br)Br |
| InChI | InChI=1S/C14H24Br2N2O2S.C2H2/c1-5-8-21-18-7-6-17(10-11(18)9-12(15)16)13(19)20-14(2,3)4;1-2/h9,11H,5-8,10H2,1-4H3;1-2H/t11-;/m0./s1 |
| InChIKey | BZFUASHNQPOTML-MERQFXBCSA-N |
| XLogP | 4.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|