C15H22Br2N2O4S — CID 123517699
tert-butyl 4-but-3-ynylsulfonyl-3-(2,2-dibromoethenyl)piperazine-1-carboxylate (PubChem CID 123517699) has the molecular formula C15H22Br2N2O4S and a molecular weight of 486.23 g/mol. Its IUPAC name is tert-butyl 4-but-3-ynylsulfonyl-3-(2,2-dibromoethenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-but-3-ynylsulfonyl-3-(2,2-dibromoethenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123517699 |
| Molecular Formula | C15H22Br2N2O4S |
| Molecular Weight | 486.23 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | tert-butyl 4-but-3-ynylsulfonyl-3-(2,2-dibromoethenyl)piperazine-1-carboxylate |
| SMILES | C#CCCS(=O)(=O)N1CCN(C(=O)OC(C)(C)C)CC1C=C(Br)Br |
| InChI | InChI=1S/C15H22Br2N2O4S/c1-5-6-9-24(21,22)19-8-7-18(11-12(19)10-13(16)17)14(20)23-15(2,3)4/h1,10,12H,6-9,11H2,2-4H3 |
| InChIKey | HPFUVLGCSNLRLM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|